CAS 131420-84-3

(2Z)-3-(5-ethyl-4-hydroxy-3-methoxynaphthalen-1-yl)-2-methylprop-2-enoic acid

Description:

The chemical substance known as (2Z)-3-(5-ethyl-4-hydroxy-3-methoxynaphthalen-1-yl)-2-methylprop-2-enoic acid, with the CAS number 131420-84-3, is a complex organic compound characterized by its unique structural features. It contains a naphthalene moiety substituted with an ethyl group, a hydroxy group, and a methoxy group, contributing to its potential biological activity. The presence of the (2Z) configuration indicates a specific geometric arrangement around the double bond, which can influence its reactivity and interactions with biological targets. This compound is likely to exhibit properties typical of organic acids, such as solubility in polar solvents and the ability to donate protons in solution. Its structural complexity suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Overall, the compound's unique functional groups and stereochemistry make it an interesting subject for research in organic chemistry and medicinal applications.

Formula: C₁₇H₁₈O₄

InChI: InChI=1/C17H18O4/c1-4-11-6-5-7-13-12(8-10(2)17(19)20)9-14(21-3)16(18)15(11)13/h5-9,18H,4H2,1-3H3,(H,19,20)/b10-8-

Synonyms:

• 2-propenoic acid, 3-(5-ethyl-4-hydroxy-3-methoxy-1-naphthalenyl)-2-methyl-, (2Z)-

DA-E 5090

CAS: 131420-84-3

DA-E 5090, an active metabolite of E 5090, inhibits IL-1 production in human monocytes.

Formula: C₁₇H₁₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 286.32

Ref: TM-T23962