CymitQuimica logo

CAS 1314241-99-0

:

7-Bromo-1,4-dihydro-4-methyl-3(2H)-isoquinolinone

Description:
7-Bromo-1,4-dihydro-4-methyl-3(2H)-isoquinolinone is a chemical compound characterized by its isoquinoline structure, which features a fused bicyclic system. The presence of a bromine atom at the 7-position and a methyl group at the 4-position contributes to its unique reactivity and potential biological activity. This compound typically exhibits a range of properties, including moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. The dihydro form indicates that it contains a saturated ring, which can influence its stability and reactivity compared to fully aromatic isoquinolines. Its molecular structure suggests potential applications in drug development, particularly in the synthesis of compounds with pharmacological properties. Additionally, the presence of the isoquinolinone moiety may confer specific characteristics such as the ability to participate in hydrogen bonding and π-π stacking interactions, which are relevant in biological systems. Overall, 7-Bromo-1,4-dihydro-4-methyl-3(2H)-isoquinolinone represents a compound with intriguing chemical properties and potential applications in various fields.
Formula:C10H10BrNO
InChI:InChI=1S/C10H10BrNO/c1-6-9-3-2-8(11)4-7(9)5-12-10(6)13/h2-4,6H,5H2,1H3,(H,12,13)
InChI key:InChIKey=JYQWNOYEAWZUDJ-UHFFFAOYSA-N
SMILES:CC1C=2C(=CC(Br)=CC2)CNC1=O
Synonyms:
  • 7-Bromo-1,4-dihydro-4-methyl-3(2H)-isoquinolinone
  • 3(2H)-Isoquinolinone, 7-bromo-1,4-dihydro-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.