CAS 131427-21-9
:1-(Phenylmethyl)-1H-indazole-3-methanol
Description:
1-(Phenylmethyl)-1H-indazole-3-methanol, with the CAS number 131427-21-9, is a chemical compound that belongs to the indazole class of compounds. It features a phenylmethyl group attached to the indazole core, which is a bicyclic structure composed of a five-membered and a six-membered ring containing nitrogen atoms. This compound typically exhibits characteristics such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the hydroxymethyl group at the 3-position of the indazole ring may influence its reactivity and interactions with biological targets. Additionally, the compound's structure suggests potential for various functional modifications, which could lead to derivatives with enhanced properties. As with many indazole derivatives, it may exhibit a range of pharmacological effects, although specific biological activities would require further investigation through experimental studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C15H14N2O
InChI:InChI=1S/C15H14N2O/c18-11-14-13-8-4-5-9-15(13)17(16-14)10-12-6-2-1-3-7-12/h1-9,18H,10-11H2
InChI key:InChIKey=AKQDXNFPEFHRLS-UHFFFAOYSA-N
SMILES:C(N1C=2C(C(CO)=N1)=CC=CC2)C3=CC=CC=C3
Synonyms:- (1-Benzyl-1H-indazol-3-yl)methanol
- 1-(Phenylmethyl)-1H-indazole-3-methanol
- 1-Benzyl-3-hydroxymethylindazole
- 1H-indazole-3-methanol, 1-(phenylmethyl)-
- 1-Benzyl-3-hydroxymethyl-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
