CAS 13143-02-7
:(4-acetylphenyl)urea
Description:
(4-Acetylphenyl)urea, with the CAS number 13143-02-7, is an organic compound characterized by its urea functional group attached to a phenyl ring that has an acetyl substituent at the para position. This compound typically appears as a white to off-white crystalline solid. It is soluble in organic solvents such as ethanol and acetone, but its solubility in water is limited due to the hydrophobic nature of the phenyl ring. The presence of the acetyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including acylation and condensation reactions. (4-Acetylphenyl)urea may exhibit biological activity, making it of interest in pharmaceutical research. Its melting point and boiling point can vary based on purity and environmental conditions. As with many organic compounds, it should be handled with care, following appropriate safety protocols to avoid exposure. Overall, (4-acetylphenyl)urea serves as a valuable compound in both synthetic organic chemistry and potential medicinal applications.
Formula:C9H10N2O2
InChI:InChI=1/C9H10N2O2/c1-6(12)7-2-4-8(5-3-7)11-9(10)13/h2-5H,1H3,(H3,10,11,13)
SMILES:CC(=O)c1ccc(cc1)NC(=N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
