CAS 1314355-33-3
:(3R)-1-[(3-Chlorophenyl)methyl]-3-pyrrolidinol
Description:
(3R)-1-[(3-Chlorophenyl)methyl]-3-pyrrolidinol is a chemical compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a chlorophenyl group at the 1-position contributes to its potential biological activity, as halogenated aromatic compounds often exhibit significant pharmacological properties. The compound features a hydroxyl group (-OH) at the 3-position of the pyrrolidine ring, which can influence its solubility and reactivity, making it a potential candidate for various chemical reactions or as a pharmaceutical agent. The stereochemistry indicated by the (3R) designation suggests that the compound has specific spatial arrangements that may affect its interaction with biological targets, such as receptors or enzymes. Overall, this compound's unique structural features may contribute to its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully understand its properties, mechanisms of action, and potential uses in various fields.
Formula:C11H14ClNO
InChI:InChI=1S/C11H14ClNO/c12-10-3-1-2-9(6-10)7-13-5-4-11(14)8-13/h1-3,6,11,14H,4-5,7-8H2/t11-/m1/s1
InChI key:InChIKey=DOZVNOAPUMMXOY-LLVKDONJSA-N
SMILES:C(N1CC[C@@H](O)C1)C2=CC(Cl)=CC=C2
Synonyms:- 3-Pyrrolidinol, 1-[(3-chlorophenyl)methyl]-, (3R)-
- (3R)-1-[(3-Chlorophenyl)methyl]-3-pyrrolidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.