CymitQuimica logo

CAS 1314355-69-5

:

2-(Cyclohexyloxy)-5-thiazolamine

Description:
2-(Cyclohexyloxy)-5-thiazolamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of the cyclohexyloxy group indicates that a cyclohexyl group is attached via an ether linkage to the thiazole nitrogen. This compound may exhibit properties typical of thiazole derivatives, such as potential biological activity, including antimicrobial or antifungal effects, due to the thiazole moiety's reactivity and ability to participate in various chemical interactions. The cyclohexyloxy group can influence the compound's solubility, stability, and overall pharmacokinetic properties. Additionally, the specific arrangement of atoms and functional groups in 2-(Cyclohexyloxy)-5-thiazolamine may contribute to its unique chemical reactivity and potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, its behavior in different environments, such as solvents or biological systems, can vary significantly based on its structural characteristics.
Formula:C9H14N2OS
InChI:InChI=1S/C9H14N2OS/c10-8-6-11-9(13-8)12-7-4-2-1-3-5-7/h6-7H,1-5,10H2
InChI key:InChIKey=RWPACQPIDFPUAN-UHFFFAOYSA-N
SMILES:O(C1=NC=C(N)S1)C2CCCCC2
Synonyms:
  • 2-(Cyclohexyloxy)-5-thiazolamine
  • 5-Thiazolamine, 2-(cyclohexyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.