CAS 131436-68-5

N-(2-Thienylmethyl)-β-alanine ethyl ester

Description:

N-(2-Thienylmethyl)-β-alanine ethyl ester is a chemical compound characterized by its unique structure, which includes a thienyl group attached to a β-alanine backbone. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The thienyl moiety, derived from thiophene, imparts aromatic characteristics and potential biological activity, making it of interest in medicinal chemistry. The β-alanine portion suggests that it may participate in various biochemical pathways, particularly in the synthesis of peptides or as a neurotransmitter modulator. The compound's molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its CAS number, 131436-68-5, provides a unique identifier for regulatory and research purposes. Overall, N-(2-Thienylmethyl)-β-alanine ethyl ester exhibits properties that may be valuable in both synthetic and pharmaceutical chemistry, warranting further investigation into its applications and effects.

Formula: C₁₀H₁₅NO₂S

InChI: InChI=1S/C10H15NO2S/c1-2-13-10(12)5-6-11-8-9-4-3-7-14-9/h3-4,7,11H,2,5-6,8H2,1H3

InChI key: InChIKey=RVUKMQHTMQHBPR-UHFFFAOYSA-N

SMILES: C(NCCC(OCC)=O)C1=CC=CS1

Synonyms:

• β-Alanine, N-(2-thienylmethyl)-, ethyl ester
• 3-[[(Thiophen-2-yl)methyl]amino]propionic acid ethyl ester
• N-(2-Thienylmethyl)-β-alanine ethyl ester

ethyl 3-{[(thiophen-2-yl)methyl]amino}propanoate

CAS: 131436-68-5

Formula: C₁₀H₁₅NO₂S

Purity: 95.0%

Molecular weight: 213.3

Ref: 10-F522777