CAS 1314378-19-2

N-[19-(1,2-Dithiolan-3-yl)-15-oxo-4,7,10-trioxa-14-azanonadec-1-yl]-2,5-dihydro-2,5-dioxo-1H-pyrrole-1-propanamide

Description:

N-[19-(1,2-Dithiolan-3-yl)-15-oxo-4,7,10-trioxa-14-azanonadec-1-yl]-2,5-dihydro-2,5-dioxo-1H-pyrrole-1-propanamide is a complex organic compound characterized by its unique structural features, including a dithiolan moiety and a pyrrole ring. The presence of multiple functional groups, such as amides and oxo groups, suggests potential reactivity and biological activity. This compound likely exhibits properties typical of both heterocyclic and sulfur-containing compounds, which may influence its solubility, stability, and interaction with biological systems. Its molecular structure indicates potential applications in medicinal chemistry, possibly as a lead compound for drug development or as a biochemical probe. The intricate arrangement of atoms and functional groups may also confer specific pharmacological properties, making it a subject of interest for further research. However, detailed studies would be necessary to fully elucidate its characteristics, including its physical properties, reactivity, and potential applications in various fields.

Formula: C₂₅H₄₁N₃O₇S₂

InChI: InChI=1S/C25H41N3O7S2/c29-22(6-2-1-5-21-10-20-36-37-21)26-11-3-14-33-16-18-35-19-17-34-15-4-12-27-23(30)9-13-28-24(31)7-8-25(28)32/h7-8,21H,1-6,9-20H2,(H,26,29)(H,27,30)

InChI key: InChIKey=CMMJPHOERVZWAY-UHFFFAOYSA-N

SMILES: C(CC(NCCCOCCOCCOCCCNC(CCCCC1CCSS1)=O)=O)N2C(=O)C=CC2=O

Synonyms:

• N-[19-(1,2-Dithiolan-3-yl)-15-oxo-4,7,10-trioxa-14-azanonadec-1-yl]-2,5-dihydro-2,5-dioxo-1H-pyrrole-1-propanamide
• 1H-Pyrrole-1-propanamide, N-[19-(1,2-dithiolan-3-yl)-15-oxo-4,7,10-trioxa-14-azanonadec-1-yl]-2,5-dihydro-2,5-dioxo-

Lipoamide-PEG3-Mal

CAS: 1314378-19-2

Lipoamide-PEG3-Mal is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₂₅H₄₁N₃O₇S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 559.74

Ref: TM-T15761

Lipoamide-PEG3-Mal

CAS: 1314378-19-2

Lipoamide-PEG3-Mal is a PEG molecule conjugated with a lipid moiety. Lipoamide-PEG3-Mal, conjugated to this lipid constituent, is very important especially in drug delivery and vaccine development as it helps improve the stability and circulation time of lipid nanoparticles (LNPs) and liposomes.

Formula: C₂₅H₄₁N₃O₇S₂

Purity: Min. 95%

Molecular weight: 559.7 g/mol

Ref: 3D-PCC37819