
CAS 1314398-16-7
:2-Fluoro-3-oxo-3-[(phenylmethyl)amino]propanoic acid
Description:
2-Fluoro-3-oxo-3-[(phenylmethyl)amino]propanoic acid is a chemical compound characterized by its unique structure, which includes a fluoro group, a ketone, and an amino acid moiety. The presence of the fluoro substituent typically enhances the compound's biological activity and lipophilicity, potentially influencing its pharmacokinetic properties. The phenylmethylamino group contributes to the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. As a propanoic acid derivative, it possesses acidic properties, which can affect its solubility and reactivity in various environments. The compound may exhibit specific stereochemistry, which can be crucial for its biological function. Overall, 2-Fluoro-3-oxo-3-[(phenylmethyl)amino]propanoic acid is a compound of interest for research in drug development and biochemical applications, particularly due to its potential interactions with enzymes or receptors in biological systems. Its CAS number, 1314398-16-7, allows for precise identification in chemical databases and literature.
Formula:C10H10FNO3
InChI:InChI=1S/C10H10FNO3/c11-8(10(14)15)9(13)12-6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,12,13)(H,14,15)
InChI key:InChIKey=QVXMZBPCMZDNGR-UHFFFAOYSA-N
SMILES:C(NC(C(C(O)=O)F)=O)C1=CC=CC=C1
Synonyms:- 2-(Benzylcarbamoyl)-2-fluoroacetic acid
- Propanoic acid, 2-fluoro-3-oxo-3-[(phenylmethyl)amino]-
- 3-(Benzylamino)-2-fluoro-3-oxo-propanoic acid
- 2-Fluoro-3-oxo-3-[(phenylmethyl)amino]propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.