CAS 1314402-09-9

1-Fluorocyclopropanemethanamine

Description:

1-Fluorocyclopropanemethanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an amine functional group. The presence of a fluorine atom introduces notable reactivity and polarity, influencing its chemical behavior and potential applications. This compound is typically colorless to pale yellow and may exhibit a distinct odor. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and synthetic applications. The amine group can participate in hydrogen bonding, enhancing solubility in polar solvents. Additionally, the fluorine substitution can affect the compound's lipophilicity and biological activity, making it a candidate for further research in drug development. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or reactivity. Overall, 1-Fluorocyclopropanemethanamine represents a fascinating area of study within organic chemistry, particularly in the context of fluorinated compounds and their derivatives.

Formula: C₄H₈FN

InChI: InChI=1S/C4H8FN/c5-4(3-6)1-2-4/h1-3,6H2

InChI key: InChIKey=RGPSNMVRDPZUDL-UHFFFAOYSA-N

SMILES: C(N)C1(F)CC1

Synonyms:

• (1-Fluorocyclopropyl)methanamine
• 1-Fluorocyclopropanemethanamine
• Cyclopropanemethanamine, 1-fluoro-