CAS 1314406-39-7

Phenol, 4-amino-2,5-difluoro-, hydrochloride (1:1)

Description:

Phenol, 4-amino-2,5-difluoro-, hydrochloride (1:1) is a chemical compound characterized by its phenolic structure, which includes an amino group and two fluorine substituents on the aromatic ring. The presence of the amino group contributes to its basicity and potential for forming hydrogen bonds, while the fluorine atoms enhance its reactivity and influence its physical properties, such as solubility and boiling point. As a hydrochloride salt, it exists in a protonated form, which typically increases its solubility in water compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the electronegative fluorine atoms, which can affect the compound's overall polarity and reactivity. Safety considerations should be taken into account when handling this substance, as both phenolic compounds and fluorinated compounds can pose health risks. Proper storage and handling protocols are essential to ensure safety in laboratory environments.

Formula: C₆H₅F₂NO·ClH

InChI: InChI=1S/C6H5F2NO.ClH/c7-3-2-6(10)4(8)1-5(3)9;/h1-2,10H,9H2;1H

InChI key: InChIKey=WBUJJNIXMAVTHW-UHFFFAOYSA-N

SMILES: FC1=C(N)C=C(F)C(O)=C1.Cl

Synonyms:

• Phenol, 4-amino-2,5-difluoro-, hydrochloride (1:1)

4-Amino-2,5-difluorophenol, HCl

CAS: 1314406-39-7

Formula: C₆H₆ClF₂NO

Molecular weight: 181.5677

Ref: IN-DA000W7D

4-Amino-2,5-difluorophenol hydrochloride

CAS: 1314406-39-7

Versatile small molecule scaffold

Formula: C₆H₆ClF₂NO

Purity: Min. 95%

Molecular weight: 181.57 g/mol

Ref: 3D-PCC40639