CymitQuimica logo

CAS 1314406-48-8

:

Methyl 5-[3-(1-naphthalenyloxy)phenyl]-2H-tetrazole-2-acetate

Description:
Methyl 5-[3-(1-naphthalenyloxy)phenyl]-2H-tetrazole-2-acetate is a chemical compound characterized by its complex structure, which includes a tetrazole ring, an acetate group, and a naphthalenyloxyphenyl moiety. This compound typically exhibits properties associated with both organic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the tetrazole ring suggests potential applications in pharmaceuticals, as tetrazoles are known for their biological activity and ability to form hydrogen bonds. The naphthalene component may contribute to its aromatic characteristics, influencing its electronic properties and interactions with other molecules. Additionally, the acetate group can enhance solubility and reactivity, making it a versatile building block in organic synthesis. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential functional properties.
Formula:C20H16N4O3
InChI:InChI=1S/C20H16N4O3/c1-26-19(25)13-24-22-20(21-23-24)15-8-4-9-16(12-15)27-18-11-5-7-14-6-2-3-10-17(14)18/h2-12H,13H2,1H3
InChI key:InChIKey=RNVHYBNJIWUDGE-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C=CC1)C=CC=C2)C3=CC(=CC=C3)C4=NN(CC(OC)=O)N=N4
Synonyms:
  • Methyl 5-[3-(1-naphthalenyloxy)phenyl]-2H-tetrazole-2-acetate
  • 2H-Tetrazole-2-acetic acid, 5-[3-(1-naphthalenyloxy)phenyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.