![Methyl 5-[3-(1-naphthalenyloxy)phenyl]-2H-tetrazole-2-acetate](https://static.cymitquimica.com/cas-image/571514-methyl-5-3-1-naphthalenyloxy-phenyl-2h-tetrazole-2-acetate.png)
CAS 1314406-48-8: Methyl 5-[3-(1-naphthalenyloxy)phenyl]-2H-tetrazole-2-acetate
Description:Methyl 5-[3-(1-naphthalenyloxy)phenyl]-2H-tetrazole-2-acetate is a chemical compound characterized by its complex structure, which includes a tetrazole ring, an acetate group, and a naphthalenyloxyphenyl moiety. This compound typically exhibits properties associated with both organic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the tetrazole ring suggests potential applications in pharmaceuticals, as tetrazoles are known for their biological activity and ability to form hydrogen bonds. The naphthalene component may contribute to its aromatic characteristics, influencing its electronic properties and interactions with other molecules. Additionally, the acetate group can enhance solubility and reactivity, making it a versatile building block in organic synthesis. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential functional properties.
Formula:C20H16N4O3
InChI:InChI=1S/C20H16N4O3/c1-26-19(25)13-24-22-20(21-23-24)15-8-4-9-16(12-15)27-18-11-5-7-14-6-2-3-10-17(14)18/h2-12H,13H2,1H3
InChI key:InChIKey=RNVHYBNJIWUDGE-UHFFFAOYSA-N
SMILES:O=C(OC)CN1N=NC(=N1)C2=CC=CC(OC3=CC=CC=4C=CC=CC34)=C2
- Synonyms:
- Methyl 5-[3-(1-naphthalenyloxy)phenyl]-2H-tetrazole-2-acetate
- 2H-Tetrazole-2-acetic acid, 5-[3-(1-naphthalenyloxy)phenyl]-, methyl ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2H-Tetrazole-2-acetic acid, 5-[3-(1-naphthalenyloxy)phenyl]-, methyl ester REF: IN-DA000W75CAS: 1314406-48-8 | - - - | To inquire | Mon 07 Apr 25 |
 | Methyl 2-(5-(3-(naphthalen-1-yloxy)phenyl)-2H-tetrazol-2-yl)acetate REF: 10-F768508CAS: 1314406-48-8 | 98% | - - - | Discontinued product |
 | Methyl 2-[5-[3-(1-naphthyloxy)phenyl]-2H-tetrazol-2-yl]acetate REF: 3D-PCC40648CAS: 1314406-48-8 | Min. 95% | - - - | Discontinued product |
![2H-Tetrazole-2-acetic acid, 5-[3-(1-naphthalenyloxy)phenyl]-, methyl ester](https://static.cymitquimica.com/products/IN/thumb/DA000W75.jpg)
2H-Tetrazole-2-acetic acid, 5-[3-(1-naphthalenyloxy)phenyl]-, methyl ester
Ref: IN-DA000W75
| Undefined size | To inquire |
Methyl 2-(5-(3-(naphthalen-1-yloxy)phenyl)-2H-tetrazol-2-yl)acetate
Ref: 10-F768508
| 5g | Discontinued | Request information |
![Methyl 2-[5-[3-(1-naphthyloxy)phenyl]-2H-tetrazol-2-yl]acetate](https://static.cymitquimica.com/products/3D/thumb/PCC40648.jpg)
Methyl 2-[5-[3-(1-naphthyloxy)phenyl]-2H-tetrazol-2-yl]acetate
Ref: 3D-PCC40648
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
