CymitQuimica logo

CAS 1314419-67-4

:

Pyrrolidine, 3-(4-fluorophenoxy)-, hydrochloride (1:1), (3R)-

Description:
Pyrrolidine, 3-(4-fluorophenoxy)-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-fluorophenoxy group indicates that a fluorinated phenyl ether is attached to the pyrrolidine at the 3-position, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The (3R)- designation refers to the specific stereochemistry of the compound, indicating that it has a particular three-dimensional arrangement that can influence its biological activity and interactions. This compound may exhibit properties relevant to medicinal chemistry, potentially acting as a pharmacological agent or serving as a building block in drug development. Its characteristics, including solubility, stability, and reactivity, are influenced by both the pyrrolidine core and the substituent groups attached to it.
Formula:C10H12FNO·ClH
InChI:InChI=1S/C10H12FNO.ClH/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10;/h1-4,10,12H,5-7H2;1H/t10-;/m1./s1
InChI key:InChIKey=RRDLUHKAJWPKCW-HNCPQSOCSA-N
SMILES:O(C1=CC=C(F)C=C1)[C@@H]2CCNC2.Cl
Synonyms:
  • (R)-3-(4-Fluorophenoxy)-pyrrolidine HCl
  • (R)-3-(4-Fluorophenoxy)-pyrrolidine Hydrochloride
  • Pyrrolidine, 3-(4-fluorophenoxy)-, hydrochloride (1:1), (3R)-
Found 4 products.