CAS 131448-16-3
:methyl 1-(trideuteriomethyl)pyridin-1-ium-3-carboxylate iodide
Description:
Methyl 1-(trideuteriomethyl)pyridin-1-ium-3-carboxylate iodide is a quaternary ammonium compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the trideuteriomethyl group indicates that three hydrogen atoms in the methyl group have been replaced with deuterium, making it useful in studies involving isotopic labeling. This compound features a carboxylate functional group, which contributes to its acidity and potential reactivity. The iodide ion serves as a counterion, influencing the solubility and stability of the compound in various solvents. Methyl 1-(trideuteriomethyl)pyridin-1-ium-3-carboxylate iodide is likely to exhibit polar characteristics due to the presence of the ionic iodide and the polar carboxylate group, making it soluble in polar solvents. Its unique isotopic composition allows for applications in NMR spectroscopy and other analytical techniques, providing insights into molecular dynamics and interactions. Overall, this compound is significant in both synthetic chemistry and analytical applications.
Formula:C8H7D3INO2
InChI:InChI=1/C8H10NO2.HI/c1-9-5-3-4-7(6-9)8(10)11-2;/h3-6H,1-2H3;1H/q+1;/p-1/i1D3;
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Methoxycarbonyl-1-(methyl-d3)pyridinium Iodide
CAS:Controlled ProductApplications 3-Methoxycarbonyl-1-(methyl-d3)pyridinium Iodide (cas# 131448-16-3) is a compound useful in organic synthesis.
Formula:C8H7D3INO2Color and Shape:NeatMolecular weight:282.09Pyridinium, 3-(methoxycarbonyl)-1-(methyl-d3)-, iodide (9CI)
CAS:Formula:C8H7D3INO2Color and Shape:SolidMolecular weight:282.0935

