CAS 13146-13-9
:benzyl 4-methylbenzenesulfinate
Description:
Benzyl 4-methylbenzenesulfinate, with the CAS number 13146-13-9, is an organic compound characterized by the presence of a benzyl group and a sulfonate functional group. It typically appears as a white to light yellow solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. The compound features a sulfonate ester, which contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of sulfonate esters and as a leaving group in nucleophilic substitution reactions. Its structure includes a methyl group on the aromatic ring, which can influence its electronic properties and steric hindrance. Benzyl 4-methylbenzenesulfinate may be used in various chemical reactions, including those involving electrophilic aromatic substitution or as a reagent in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H14O2S
InChI:InChI=1/C14H14O2S/c1-12-7-9-14(10-8-12)17(15)16-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
