CymitQuimica logo

CAS 1314698-96-8

:

3-(1-Aminocyclobutyl)-4-bromophenol

Description:
3-(1-Aminocyclobutyl)-4-bromophenol is a chemical compound characterized by its unique structure, which includes a bromophenol moiety and a cyclobutyl group with an amino substituent. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential applications in organic synthesis and medicinal chemistry. The amino group contributes to the compound's basicity and can participate in hydrogen bonding, which may enhance its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the cyclobutyl and bromophenol groups. Overall, 3-(1-Aminocyclobutyl)-4-bromophenol presents a fascinating subject for further investigation in both synthetic and applied chemistry contexts.
Formula:C10H12BrNO
InChI:InChI=1S/C10H12BrNO/c11-9-3-2-7(13)6-8(9)10(12)4-1-5-10/h2-3,6,13H,1,4-5,12H2
InChI key:InChIKey=DJBNOYPVKBWPOC-UHFFFAOYSA-N
SMILES:NC1(CCC1)C2=C(Br)C=CC(O)=C2
Synonyms:
  • 3-(1-Aminocyclobutyl)-4-bromophenol
  • Phenol, 3-(1-aminocyclobutyl)-4-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.