CymitQuimica logo

CAS 1314714-46-9

:

1-[3,5-Bis(trifluoromethyl)phenyl]cyclobutanamine

Description:
1-[3,5-Bis(trifluoromethyl)phenyl]cyclobutanamine is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a phenyl group substituted with two trifluoromethyl groups at the 3 and 5 positions. The presence of these trifluoromethyl groups significantly influences the compound's electronic properties, making it highly lipophilic and potentially enhancing its biological activity. The cyclobutanamine moiety contributes to the compound's rigidity and may affect its conformational dynamics. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Its specific interactions with biological targets can be influenced by the steric and electronic effects of the trifluoromethyl groups. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, making it a subject of study in various chemical contexts. Overall, 1-[3,5-Bis(trifluoromethyl)phenyl]cyclobutanamine exemplifies the intricate relationship between molecular structure and chemical behavior.
Formula:C12H11F6N
InChI:InChI=1S/C12H11F6N/c13-11(14,15)8-4-7(10(19)2-1-3-10)5-9(6-8)12(16,17)18/h4-6H,1-3,19H2
InChI key:InChIKey=FIABVIFHYFWXPA-UHFFFAOYSA-N
SMILES:NC1(C2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)CCC1
Synonyms:
  • Cyclobutanamine, 1-[3,5-bis(trifluoromethyl)phenyl]-
  • 1-[3,5-Bis(trifluoromethyl)phenyl]cyclobutanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.