CymitQuimica logo

CAS 1314756-43-8

:

1-(5-Bromo-2-fluorophenyl)cyclobutanecarbonitrile

Description:
1-(5-Bromo-2-fluorophenyl)cyclobutanecarbonitrile is an organic compound characterized by its unique structure, which includes a cyclobutane ring and a cyano group attached to a phenyl ring that is substituted with both bromine and fluorine atoms. The presence of these halogen substituents can significantly influence the compound's reactivity, polarity, and overall chemical behavior. The bromine atom typically enhances the compound's electrophilicity, while the fluorine atom can affect its electronic properties due to its high electronegativity. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry. Additionally, the cyano group contributes to the compound's potential as a building block in organic synthesis, allowing for further functionalization. Its physical properties, such as solubility and melting point, would depend on the specific interactions between its functional groups and the solvent environment. Overall, 1-(5-Bromo-2-fluorophenyl)cyclobutanecarbonitrile represents a versatile structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H9BrFN
InChI:InChI=1S/C11H9BrFN/c12-8-2-3-10(13)9(6-8)11(7-14)4-1-5-11/h2-3,6H,1,4-5H2
InChI key:InChIKey=HUAYUMFCAVCWJC-UHFFFAOYSA-N
SMILES:C(#N)C1(CCC1)C2=C(F)C=CC(Br)=C2
Synonyms:
  • 1-(5-Bromo-2-fluorophenyl)cyclobutanecarbonitrile
  • Cyclobutanecarbonitrile, 1-(5-bromo-2-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.