
CAS 1314785-90-4
:1-(4-Bromo-3-fluorophenyl)cyclobutanamine
Description:
1-(4-Bromo-3-fluorophenyl)cyclobutanamine is a chemical compound characterized by its unique structure, which includes a cyclobutane ring attached to a phenyl group that is further substituted with bromine and fluorine atoms. The presence of these halogens introduces significant polarity and can influence the compound's reactivity and interaction with biological systems. The cyclobutane moiety contributes to the compound's rigidity, potentially affecting its conformational flexibility and steric properties. This compound may exhibit interesting pharmacological activities due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the presence of the amine functional group suggests potential for hydrogen bonding, which can enhance solubility in polar solvents and influence its biological activity. Overall, 1-(4-Bromo-3-fluorophenyl)cyclobutanamine is a complex molecule with potential applications in drug development and materials science, warranting further investigation into its properties and effects.
Formula:C10H11BrFN
InChI:InChI=1S/C10H11BrFN/c11-8-3-2-7(6-9(8)12)10(13)4-1-5-10/h2-3,6H,1,4-5,13H2
InChI key:InChIKey=WXCSGKKFDFNHEM-UHFFFAOYSA-N
SMILES:NC1(CCC1)C2=CC(F)=C(Br)C=C2
Synonyms:- 1-(4-Bromo-3-fluorophenyl)cyclobutanamine
- Cyclobutanamine, 1-(4-bromo-3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.