CAS 1314790-91-4

4-Bromo-2-methoxy-α,α-dimethylbenzeneacetic acid

Description:

4-Bromo-2-methoxy-α,α-dimethylbenzeneacetic acid, with the CAS number 1314790-91-4, is an organic compound characterized by its aromatic structure and functional groups. It features a bromine atom and a methoxy group attached to a dimethyl-substituted benzene ring, contributing to its unique chemical properties. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses and applications. The bromine substituent may enhance its reactivity in electrophilic aromatic substitution reactions, while the methoxy group can influence its solubility and polarity. This compound may exhibit biological activity, which is often explored in medicinal chemistry. Its structural features suggest potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, specific applications and biological effects would require further investigation through empirical studies and research.

Formula: C₁₁H₁₃BrO₃

InChI: InChI=1S/C11H13BrO3/c1-11(2,10(13)14)8-5-4-7(12)6-9(8)15-3/h4-6H,1-3H3,(H,13,14)

InChI key: InChIKey=SQOLAOMPYYYWNW-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)(C)C1=C(OC)C=C(Br)C=C1

Synonyms:

• Benzeneacetic acid, 4-bromo-2-methoxy-α,α-dimethyl-
• 4-Bromo-2-methoxy-α,α-dimethylbenzeneacetic acid