
CAS 13148-63-5
:2-(Phenylmethyl)-1,3,4-oxadiazole
Description:
2-(Phenylmethyl)-1,3,4-oxadiazole, identified by its CAS number 13148-63-5, is a heterocyclic organic compound featuring an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. This compound is characterized by the presence of a phenylmethyl group, which contributes to its aromatic properties and potential reactivity. Typically, oxadiazoles exhibit interesting biological activities, including antimicrobial and anti-inflammatory properties, making them of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its aromatic structure. Its chemical behavior can be influenced by the electron-withdrawing or donating effects of the phenylmethyl group, which can affect its reactivity in various chemical reactions. Additionally, the presence of the oxadiazole moiety may allow for the formation of hydrogen bonds, impacting its interactions in biological systems. Overall, 2-(Phenylmethyl)-1,3,4-oxadiazole represents a class of compounds with diverse applications in pharmaceuticals and materials science.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c1-2-4-8(5-3-1)6-9-11-10-7-12-9/h1-5,7H,6H2
InChI key:InChIKey=QBXCAUWVKMECDN-UHFFFAOYSA-N
SMILES:C(C1=CC=CC=C1)C2=NN=CO2
Synonyms:- 1,3,4-Oxadiazole, 2-(phenylmethyl)-
- 2-Benzyl-1,3,4-oxadiazole
- 2-(Phenylmethyl)-1,3,4-oxadiazole
- 1,3,4-Oxadiazole, 2-benzyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
