
CAS 1314894-46-6
:1-(5-Bromo-3-thienyl)-2,2,2-trifluoroethanone
Description:
1-(5-Bromo-3-thienyl)-2,2,2-trifluoroethanone is a chemical compound characterized by its unique structure, which includes a thienyl group and a trifluoroethanone moiety. The presence of the bromine atom and trifluoromethyl groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits a moderate to high level of lipophilicity due to the trifluoromethyl group, which can influence its biological activity and solubility in organic solvents. The thienyl ring, a five-membered aromatic heterocycle containing sulfur, can participate in various chemical reactions, making this compound a valuable intermediate in the synthesis of more complex molecules. Additionally, the bromine substituent can serve as a site for further functionalization, allowing for the development of derivatives with tailored properties. Overall, 1-(5-Bromo-3-thienyl)-2,2,2-trifluoroethanone is of interest in research fields focused on agrochemicals, pharmaceuticals, and materials science due to its distinctive chemical characteristics.
Formula:C6H2BrF3OS
InChI:InChI=1S/C6H2BrF3OS/c7-4-1-3(2-12-4)5(11)6(8,9)10/h1-2H
InChI key:InChIKey=LGENIRIRTKRCBG-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C=1C=C(Br)SC1
Synonyms:- 1-(5-Bromothiophen-3-yl)-2,2,2-trifluoroethanone
- Ethanone, 1-(5-bromo-3-thienyl)-2,2,2-trifluoro-
- 1-(5-Bromo-3-thienyl)-2,2,2-trifluoroethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
