CymitQuimica logo

CAS 1314902-40-3

:

5-Fluoro-α,α,2-trimethylbenzeneethanol

Description:
5-Fluoro-α,α,2-trimethylbenzeneethanol, identified by its CAS number 1314902-40-3, is an organic compound characterized by the presence of a fluorine atom and a hydroxyl group attached to a substituted aromatic ring. This compound features a trimethylbenzene structure, which contributes to its hydrophobic properties, while the hydroxyl group provides potential for hydrogen bonding, influencing its solubility and reactivity. The fluorine substitution can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and material science. The presence of multiple methyl groups can also impact the steric hindrance around the reactive sites, potentially influencing its reactivity and interactions with other molecules. Overall, 5-Fluoro-α,α,2-trimethylbenzeneethanol exhibits unique chemical properties that can be leveraged in various applications, including pharmaceuticals and agrochemicals, although specific applications would depend on further research into its behavior and interactions in different environments.
Formula:C11H15FO
InChI:InChI=1S/C11H15FO/c1-8-4-5-10(12)6-9(8)7-11(2,3)13/h4-6,13H,7H2,1-3H3
InChI key:InChIKey=STFOCRZVOPHUMC-UHFFFAOYSA-N
SMILES:C(C(C)(C)O)C1=C(C)C=CC(F)=C1
Synonyms:
  • 5-Fluoro-α,α,2-trimethylbenzeneethanol
  • Benzeneethanol, 5-fluoro-α,α,2-trimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.