CAS 1314903-63-3
:4-(Ethylthio)-2-fluoro-1-methoxybenzene
Description:
4-(Ethylthio)-2-fluoro-1-methoxybenzene, with the CAS number 1314903-63-3, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3), a fluorine atom, and an ethylthio group (-S-ethyl) attached to a benzene ring. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its electronic properties, making it useful in various chemical applications. The ethylthio group contributes to the compound's overall hydrophobic character, potentially affecting its solubility in different solvents. This compound may exhibit interesting biological activities due to its unique functional groups, making it a candidate for further research in medicinal chemistry. Additionally, its synthesis and reactivity can be influenced by the substituents on the benzene ring, which can affect the compound's stability and interaction with other chemical species. Overall, 4-(Ethylthio)-2-fluoro-1-methoxybenzene represents a versatile structure in organic synthesis and pharmaceutical development.
Formula:C9H11FOS
InChI:InChI=1S/C9H11FOS/c1-3-12-7-4-5-9(11-2)8(10)6-7/h4-6H,3H2,1-2H3
InChI key:InChIKey=KXIAGCBRIKSREL-UHFFFAOYSA-N
SMILES:S(CC)C1=CC(F)=C(OC)C=C1
Synonyms:- 4-(Ethylthio)-2-fluoro-1-methoxybenzene
- Benzene, 4-(ethylthio)-2-fluoro-1-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.