CAS 1314903-64-4

4-Fluoro-3-methylbutanoic acid

Description:

4-Fluoro-3-methylbutanoic acid is an organic compound characterized by the presence of a carboxylic acid functional group, which imparts acidic properties. It features a four-carbon backbone with a methyl group and a fluorine atom attached to the third and fourth carbon atoms, respectively. This structural arrangement contributes to its unique chemical behavior and reactivity. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its interaction with biological systems, making it of interest in pharmaceutical and agrochemical applications. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. Its solubility in polar solvents is generally good due to the carboxylic acid group, while its volatility may vary. Safety data should be consulted for handling, as with many fluorinated compounds, it may pose health risks. Overall, 4-Fluoro-3-methylbutanoic acid is a valuable compound in synthetic chemistry and research, particularly in the development of fluorinated derivatives.

Formula: C₅H₉FO₂

InChI: InChI=1S/C5H9FO2/c1-4(3-6)2-5(7)8/h4H,2-3H2,1H3,(H,7,8)

InChI key: InChIKey=UADMTAKPNCQPNT-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(CF)C

Synonyms:

• 4-Fluoro-3-methylbutanoic acid
• Butanoic acid, 4-fluoro-3-methyl-