
CAS 1314915-89-3
:1H-Pyrazole-4-propanol, β-amino-1-methyl-, hydrochloride (1:1)
Description:
1H-Pyrazole-4-propanol, β-amino-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a hydroxyl group (-OH) and an amino group (-NH2) attached to the propanol chain, contributing to its potential as a bioactive molecule. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its pharmacological properties. Typically, such compounds are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The presence of both the hydroxyl and amino groups suggests that this compound may participate in hydrogen bonding, which can affect its reactivity and interaction with other molecules. As with many pyrazole derivatives, it may exhibit a range of biological activities, making it of interest in various fields, including drug discovery and development.
Formula:C7H13N3O·ClH
InChI:InChI=1S/C7H13N3O.ClH/c1-10-4-6(3-9-10)2-7(8)5-11;/h3-4,7,11H,2,5,8H2,1H3;1H
InChI key:InChIKey=BXBUHLOYMGGVKA-UHFFFAOYSA-N
SMILES:C(C(CO)N)C1=CN(C)N=C1.Cl
Synonyms:- 1H-Pyrazole-4-propanol, β-amino-1-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.