CAS 1314922-71-8

(5-Chloro-5-hexen-1-yl)benzene

Description:

(5-Chloro-5-hexen-1-yl)benzene, with the CAS number 1314922-71-8, is an organic compound characterized by the presence of a benzene ring substituted with a 5-chloro-5-hexen-1-yl group. This structure indicates that it contains a chlorine atom attached to a carbon chain that includes a double bond, contributing to its reactivity and potential applications in organic synthesis. The compound is likely to exhibit hydrophobic properties due to the aromatic benzene moiety, which can influence its solubility in various solvents. Additionally, the presence of the double bond in the hexenyl group may allow for further chemical modifications through reactions such as electrophilic addition or polymerization. As with many chlorinated compounds, it may also exhibit specific biological activities or environmental considerations, necessitating careful handling and assessment of its safety profile. Overall, (5-Chloro-5-hexen-1-yl)benzene represents a versatile building block in organic chemistry, with potential uses in pharmaceuticals, agrochemicals, or materials science.

Formula: C₁₂H₁₅Cl

InChI: InChI=1S/C12H15Cl/c1-11(13)7-5-6-10-12-8-3-2-4-9-12/h2-4,8-9H,1,5-7,10H2

InChI key: InChIKey=JPTXYQAGGOFBNX-UHFFFAOYSA-N

SMILES: C(CCCC(=C)Cl)C1=CC=CC=C1

Synonyms:

• 2-Chloro-6-phenyl-1-hexene
• (5-Chloro-5-hexen-1-yl)benzene
• Benzene, (5-chloro-5-hexen-1-yl)-