CymitQuimica logo

CAS 1314928-42-1

:

N3-Cyclopropyl-3,4-pyridinediamine

Description:
N3-Cyclopropyl-3,4-pyridinediamine is a chemical compound characterized by its unique bicyclic structure, which includes a pyridine ring and a cyclopropyl group. The presence of two amino groups (diamines) on the pyridine ring enhances its reactivity and potential for forming various derivatives. This compound is typically studied for its biological activity, particularly in medicinal chemistry, where it may exhibit properties relevant to drug development. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in pharmacology. The cyclopropyl moiety can influence the compound's lipophilicity and steric properties, which are crucial for its biological efficacy. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Overall, N3-Cyclopropyl-3,4-pyridinediamine represents a class of compounds that may have significant implications in therapeutic applications, warranting further investigation into its properties and potential uses.
Formula:C8H11N3
InChI:InChI=1S/C8H11N3/c9-7-3-4-10-5-8(7)11-6-1-2-6/h3-6,11H,1-2H2,(H2,9,10)
InChI key:InChIKey=LXWOEZGSEOIVNS-UHFFFAOYSA-N
SMILES:N(C=1C(N)=CC=NC1)C2CC2
Synonyms:
  • 3,4-Pyridinediamine, N3-cyclopropyl-
  • N3-Cyclopropyl-3,4-pyridinediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.