CAS 1314931-18-4

3-[1-(1H-Imidazol-5-yl)ethyl]benzonitrile

Description:

3-[1-(1H-Imidazol-5-yl)ethyl]benzonitrile, with the CAS number 1314931-18-4, is a chemical compound characterized by its unique structure that combines a benzonitrile moiety with an imidazole-containing side chain. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the imidazole ring, which is known for its role in various biochemical processes. The benzonitrile part contributes to its stability and lipophilicity, making it suitable for applications in medicinal chemistry and drug development. The compound may also display specific solubility characteristics, reactivity, and interaction with biological targets, which can be influenced by the functional groups present. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in research related to pharmacology, particularly in the development of new therapeutic agents. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₁₂H₁₁N₃

InChI: InChI=1S/C12H11N3/c1-9(12-7-14-8-15-12)11-4-2-3-10(5-11)6-13/h2-5,7-9H,1H3,(H,14,15)

InChI key: InChIKey=PFISQWLYGQGULU-UHFFFAOYSA-N

SMILES: C(C)(C1=CC(C#N)=CC=C1)C2=CN=CN2

Synonyms:

• Benzonitrile, 3-[1-(1H-imidazol-5-yl)ethyl]-
• 3-[1-(1H-Imidazol-5-yl)ethyl]benzonitrile

3-[1-(1H-Imidazol-4-yl)ethyl]benzonitrile

CAS: 1314931-18-4

Versatile small molecule scaffold

Formula: C₁₂H₁₁N₃

Purity: Min. 95%

Molecular weight: 197.24 g/mol

Ref: 3D-PCC93118