
CAS 1314937-92-2
:2-(Chloromethyl)-2,4,4-trimethylpentane
Description:
2-(Chloromethyl)-2,4,4-trimethylpentane is an organic compound characterized by its chloromethyl group attached to a branched alkane structure. This compound features a central carbon atom bonded to a chlorine atom, contributing to its reactivity and potential applications in organic synthesis. The presence of multiple methyl groups on the carbon backbone enhances its steric hindrance, which can influence its physical properties, such as boiling and melting points, as well as its solubility in various solvents. Typically, compounds with such branched structures exhibit lower boiling points compared to their straight-chain counterparts due to reduced surface area and van der Waals interactions. Additionally, the chloromethyl group can serve as a functional handle for further chemical modifications, making it valuable in the synthesis of more complex molecules. Safety considerations should be taken into account when handling this compound, as chlorinated hydrocarbons can pose health risks and environmental concerns. Overall, 2-(Chloromethyl)-2,4,4-trimethylpentane is a notable compound in the realm of organic chemistry, particularly in synthetic applications.
Formula:C9H19Cl
InChI:InChI=1S/C9H19Cl/c1-8(2,3)6-9(4,5)7-10/h6-7H2,1-5H3
InChI key:InChIKey=AWJLAPBZNYYURW-UHFFFAOYSA-N
SMILES:C(C(CCl)(C)C)C(C)(C)C
Synonyms:- Pentane, 2-(chloromethyl)-2,4,4-trimethyl-
- 2-(Chloromethyl)-2,4,4-trimethylpentane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.