CAS 1314959-59-5

(5-Ethoxy-2-fluorophenyl)hydrazine

Description:

(5-Ethoxy-2-fluorophenyl)hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a substituted aromatic ring. The compound features a fluorine atom and an ethoxy group on the phenyl ring, which influence its chemical reactivity and physical properties. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of electronegative atoms like fluorine and oxygen, which can affect solubility in various solvents. The hydrazine moiety is known for its potential reactivity, particularly in forming hydrazones and undergoing oxidation reactions. Additionally, the presence of the ethoxy group can enhance the compound's lipophilicity, potentially affecting its biological activity and interaction with other molecules. As with many hydrazine derivatives, (5-Ethoxy-2-fluorophenyl)hydrazine may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, safety precautions should be taken when handling such compounds due to the potential toxicity associated with hydrazines.

Formula: C₈H₁₁FN₂O

InChI: InChI=1S/C8H11FN2O/c1-2-12-6-3-4-7(9)8(5-6)11-10/h3-5,11H,2,10H2,1H3

InChI key: InChIKey=FPVDBRCDBIBLBQ-UHFFFAOYSA-N

SMILES: N(N)C1=CC(OCC)=CC=C1F

Synonyms:

• (5-Ethoxy-2-fluorophenyl)hydrazine
• Hydrazine, (5-ethoxy-2-fluorophenyl)-