
CAS 1314960-42-3
:5-Fluoro-2-hydrazinyl-3-methylpyridine
Description:
5-Fluoro-2-hydrazinyl-3-methylpyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 5-position and a hydrazinyl group at the 2-position contributes to its unique reactivity and potential biological activity. The methyl group at the 3-position adds to the compound's steric and electronic properties. This compound may exhibit properties typical of both hydrazines and pyridines, such as potential nucleophilicity due to the hydrazinyl group and aromatic stability from the pyridine structure. It is important in medicinal chemistry and may serve as a building block for the synthesis of more complex molecules, particularly in the development of pharmaceuticals. The compound's specific interactions, solubility, and stability can vary based on environmental conditions and the presence of other functional groups. As with many nitrogen-containing compounds, it may also exhibit interesting biological activities, warranting further investigation in drug discovery and development contexts.
Formula:C6H8FN3
InChI:InChI=1S/C6H8FN3/c1-4-2-5(7)3-9-6(4)10-8/h2-3H,8H2,1H3,(H,9,10)
InChI key:InChIKey=HMTJVMXJVSCPMW-UHFFFAOYSA-N
SMILES:N(N)=C1C(C)=CC(F)=CN1
Synonyms:- Pyridine, 5-fluoro-2-hydrazinyl-3-methyl-
- 5-Fluoro-2-hydrazinyl-3-methylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
