CymitQuimica logo

CAS 1314966-11-4

:

1-Ethyl-1H-pyrazole-5-propanamine

Description:
1-Ethyl-1H-pyrazole-5-propanamine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound features an ethyl group and a propanamine substituent, contributing to its unique properties. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the compound may have applications in pharmaceuticals or agrochemicals due to its potential biological activity, although specific uses would depend on further research and development. Its molecular structure allows for various interactions, making it a subject of interest in synthetic chemistry and material science. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C8H15N3
InChI:InChI=1S/C8H15N3/c1-2-11-8(4-3-6-9)5-7-10-11/h5,7H,2-4,6,9H2,1H3
InChI key:InChIKey=PTTUFJPTOBHZAU-UHFFFAOYSA-N
SMILES:C(CCN)C=1N(CC)N=CC1
Synonyms:
  • 1H-Pyrazole-5-propanamine, 1-ethyl-
  • 1-Ethyl-1H-pyrazole-5-propanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.