CAS 1314973-15-3

2-Hydrazinyl-N,N-dimethylbenzenamine

Description:

2-Hydrazinyl-N,N-dimethylbenzenamine, also known by its CAS number 1314973-15-3, is an organic compound characterized by the presence of a hydrazine functional group attached to a dimethyl-substituted aniline structure. This compound typically exhibits properties associated with both hydrazines and aromatic amines, including potential reactivity due to the presence of the hydrazine moiety, which can participate in various chemical reactions such as oxidation and condensation. The dimethyl groups contribute to its steric hindrance and influence its solubility and reactivity. In terms of physical properties, it may be a solid or liquid at room temperature, depending on its specific formulation and purity. The compound's applications could span fields such as pharmaceuticals, agrochemicals, or materials science, particularly in the synthesis of more complex molecules or as intermediates in chemical reactions. However, due to the presence of hydrazine, it may also pose health risks, necessitating careful handling and appropriate safety measures.

Formula: C₈H₁₃N₃

InChI: InChI=1S/C8H13N3/c1-11(2)8-6-4-3-5-7(8)10-9/h3-6,10H,9H2,1-2H3

InChI key: InChIKey=UFOIZPRVCWJMCQ-UHFFFAOYSA-N

SMILES: N(N)C1=C(N(C)C)C=CC=C1

Synonyms:

• 2-Hydrazinyl-N,N-dimethylaniline
• Benzenamine, 2-hydrazinyl-N,N-dimethyl-
• 2-Hydrazinyl-N,N-dimethylbenzenamine