CAS 1314976-60-7
:α,α,2,3-Tetramethylbenzeneethanol
Description:
α,α,2,3-Tetramethylbenzeneethanol, identified by its CAS number 1314976-60-7, is an organic compound characterized by a complex structure that includes a benzene ring substituted with multiple methyl groups and a hydroxyl (alcohol) functional group. This compound is part of the larger family of alkyl-substituted phenols, which are known for their diverse chemical properties and potential applications. The presence of four methyl groups contributes to its steric hindrance, influencing its reactivity and solubility in various solvents. Typically, such compounds exhibit moderate to low volatility and can be relatively stable under standard conditions. The hydroxyl group imparts polar characteristics, allowing for hydrogen bonding, which can affect the compound's solubility in polar solvents. Additionally, the bulky methyl substituents may lead to unique physical properties, such as increased viscosity and altered melting and boiling points compared to simpler phenolic compounds. Overall, α,α,2,3-Tetramethylbenzeneethanol is of interest in both synthetic organic chemistry and potential industrial applications.
Formula:C12H18O
InChI:InChI=1S/C12H18O/c1-9-6-5-7-11(10(9)2)8-12(3,4)13/h5-7,13H,8H2,1-4H3
InChI key:InChIKey=HCLBNHFVFCUDLZ-UHFFFAOYSA-N
SMILES:C(C(C)(C)O)C1=C(C)C(C)=CC=C1
Synonyms:- Benzeneethanol, α,α,2,3-tetramethyl-
- α,α,2,3-Tetramethylbenzeneethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.