CymitQuimica logo

CAS 1314976-64-1

:

4-Methoxy-3,5-dimethylbenzeneethanethiol

Description:
4-Methoxy-3,5-dimethylbenzeneethanethiol, also known by its CAS number 1314976-64-1, is an organic compound characterized by its aromatic structure, which includes a methoxy group and two methyl groups attached to a benzene ring. This compound features a thiol functional group (-SH) linked to an ethyl chain, contributing to its reactivity and potential applications in organic synthesis and as a building block in medicinal chemistry. The presence of the methoxy and methyl substituents influences its physical properties, such as solubility and boiling point, while also affecting its electronic characteristics, making it a candidate for various chemical reactions. Thiols are known for their strong odors and can participate in redox reactions, making this compound potentially useful in the synthesis of more complex molecules. Additionally, the compound's structure suggests it may exhibit interesting biological activities, warranting further investigation in pharmacological contexts. Overall, 4-Methoxy-3,5-dimethylbenzeneethanethiol represents a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C11H16OS
InChI:InChI=1S/C11H16OS/c1-8-6-10(4-5-13)7-9(2)11(8)12-3/h6-7,13H,4-5H2,1-3H3
InChI key:InChIKey=HURCALKMQGZTPM-UHFFFAOYSA-N
SMILES:O(C)C1=C(C)C=C(CCS)C=C1C
Synonyms:
  • Benzeneethanethiol, 4-methoxy-3,5-dimethyl-
  • 4-Methoxy-3,5-dimethylbenzeneethanethiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.