CAS 1314985-41-5
:2-Chloro-1-(cyclopropylmethoxy)-4-fluorobenzene
Description:
2-Chloro-1-(cyclopropylmethoxy)-4-fluorobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a chlorine atom and a fluorine atom, as well as a cyclopropylmethoxy group. The presence of the chlorine and fluorine substituents indicates potential reactivity and influence on the compound's electronic properties, making it of interest in various chemical applications, including medicinal chemistry and materials science. The cyclopropylmethoxy group introduces a unique three-membered ring structure that can affect the compound's steric and electronic characteristics, potentially enhancing its biological activity or altering its solubility. This compound may exhibit specific interactions with biological targets, making it a candidate for further investigation in drug development. Additionally, its molecular structure suggests potential for various synthetic transformations, which could be explored for the development of related compounds. Overall, 2-Chloro-1-(cyclopropylmethoxy)-4-fluorobenzene represents a versatile structure with implications in both theoretical and applied chemistry.
Formula:C10H10ClFO
InChI:InChI=1S/C10H10ClFO/c11-9-5-8(12)3-4-10(9)13-6-7-1-2-7/h3-5,7H,1-2,6H2
InChI key:InChIKey=DGIDIOQWOUEYJC-UHFFFAOYSA-N
SMILES:O(CC1CC1)C2=C(Cl)C=C(F)C=C2
Synonyms:- 2-Chloro-1-(cyclopropylmethoxy)-4-fluorobenzene
- Benzene, 2-chloro-1-(cyclopropylmethoxy)-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
