
CAS 1314985-89-1
:2-(6-Amino-3-pyridinyl)-4-fluorophenol
Description:
2-(6-Amino-3-pyridinyl)-4-fluorophenol, with the CAS number 1314985-89-1, is a chemical compound characterized by its unique structural features, which include a fluorophenol moiety and a pyridine ring substituted with an amino group. This compound typically exhibits properties associated with both aromatic amines and phenolic compounds, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the hydroxyl (-OH) group. The fluorine atom introduces electronegative characteristics that can influence the compound's reactivity and interaction with biological systems. Additionally, the amino group can enhance the compound's basicity and may play a role in its biological activity, making it of interest in medicinal chemistry. Overall, the compound's structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, although specific biological or chemical properties would require further investigation through experimental studies.
Formula:C11H9FN2O
InChI:InChI=1S/C11H9FN2O/c12-8-2-3-10(15)9(5-8)7-1-4-11(13)14-6-7/h1-6,15H,(H2,13,14)
InChI key:InChIKey=WSLDMDJJKUVZPT-UHFFFAOYSA-N
SMILES:OC1=C(C=C(F)C=C1)C=2C=CC(N)=NC2
Synonyms:- Phenol, 2-(6-amino-3-pyridinyl)-4-fluoro-
- 2-(6-Amino-3-pyridinyl)-4-fluorophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.