CAS 1314987-26-2

Phenylmethyl N-[4-(6-amino-3-pyridinyl)phenyl]carbamate

Description:

Phenylmethyl N-[4-(6-amino-3-pyridinyl)phenyl]carbamate, identified by its CAS number 1314987-26-2, is a chemical compound that belongs to the class of carbamates. This substance features a phenylmethyl group attached to a carbamate functional group, which is further substituted with a pyridine derivative. The presence of the amino group on the pyridine ring suggests potential for hydrogen bonding and reactivity, which may influence its biological activity. The compound's structure indicates it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's potential applications could include use as a therapeutic agent or in research settings, particularly in studies related to enzyme inhibition or receptor binding. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₉H₁₇N₃O₂

InChI: InChI=1S/C19H17N3O2/c20-18-11-8-16(12-21-18)15-6-9-17(10-7-15)22-19(23)24-13-14-4-2-1-3-5-14/h1-12H,13H2,(H2,20,21)(H,22,23)

InChI key: InChIKey=IQWGIKIHRRCWNG-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)C2=CC=C(C=C2)C=3C=CC(N)=NC3

Synonyms:

• Carbamic acid, N-[4-(6-amino-3-pyridinyl)phenyl]-, phenylmethyl ester
• Phenylmethyl N-[4-(6-amino-3-pyridinyl)phenyl]carbamate

2-Amino-5-(4-Cbz-Aminophenyl)pyridine

CAS: 1314987-26-2

Formula: C₁₉H₁₇N₃O₂

Molecular weight: 319.3572

Ref: IN-DA000WC0