CAS 1314987-28-4
:4-Bromo-5-fluoro-N-(1-methylethyl)-2-nitrobenzenamine
Description:
4-Bromo-5-fluoro-N-(1-methylethyl)-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a nitro group, a bromine atom, and a fluorine atom attached to a benzene ring. The presence of the nitro group (-NO2) indicates that it is a nitroaromatic compound, which often exhibits significant reactivity due to the electron-withdrawing nature of the nitro group. The bromo and fluoro substituents contribute to its halogenated properties, potentially affecting its solubility and reactivity in various chemical environments. The N-(1-methylethyl) moiety suggests the presence of an isopropyl group, which can influence the compound's steric hindrance and overall stability. This compound may be of interest in pharmaceutical chemistry and materials science due to its unique functional groups, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its specific applications would depend on further studies regarding its biological activity and chemical behavior.
Formula:C9H10BrFN2O2
InChI:InChI=1S/C9H10BrFN2O2/c1-5(2)12-8-4-7(11)6(10)3-9(8)13(14)15/h3-5,12H,1-2H3
InChI key:InChIKey=BPXMIORTUXUUGS-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=C(N(=O)=O)C=C(Br)C(F)=C1
Synonyms:- 4-Bromo-5-fluoro-N-(1-methylethyl)-2-nitrobenzenamine
- Benzenamine, 4-bromo-5-fluoro-N-(1-methylethyl)-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
