CAS 1314987-30-8
:1-(1,1-Dimethylethyl)-6-ethoxy-1H-benzimidazole
Description:
1-(1,1-Dimethylethyl)-6-ethoxy-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with an ethoxy group and a tert-butyl group. This compound typically exhibits properties associated with both the benzimidazole class and the substituents attached to it. Benzimidazoles are known for their diverse biological activities, including antifungal, antiviral, and anticancer properties. The presence of the ethoxy group can enhance solubility and influence the compound's reactivity, while the tert-butyl group may contribute to steric hindrance, potentially affecting the compound's interaction with biological targets. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be influenced by these substituents. Overall, 1-(1,1-Dimethylethyl)-6-ethoxy-1H-benzimidazole represents a class of compounds that may have significant applications in pharmaceuticals and agrochemicals, although specific biological activity and safety profiles would require further investigation.
Formula:C13H18N2O
InChI:InChI=1S/C13H18N2O/c1-5-16-10-6-7-11-12(8-10)15(9-14-11)13(2,3)4/h6-9H,5H2,1-4H3
InChI key:InChIKey=BBILNFAVMQFQIT-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C=2C(N=C1)=CC=C(OCC)C2
Synonyms:- 1H-Benzimidazole, 1-(1,1-dimethylethyl)-6-ethoxy-
- 1-(1,1-Dimethylethyl)-6-ethoxy-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
