CAS 1314987-35-3
:1-(1,1-Dimethylethyl)-6,7-difluoro-1H-benzimidazole
Description:
1-(1,1-Dimethylethyl)-6,7-difluoro-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a tert-butyl group and two fluorine atoms at the 6 and 7 positions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of fluorine atoms often enhances the compound's stability and lipophilicity, making it of interest in various applications, including pharmaceuticals and agrochemicals. The tert-butyl group contributes to steric hindrance, which can influence the compound's reactivity and interactions with biological targets. Additionally, the benzimidazole moiety is known for its biological activity, often serving as a scaffold in drug design. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in both synthetic and medicinal chemistry.
Formula:C11H12F2N2
InChI:InChI=1S/C11H12F2N2/c1-11(2,3)15-6-14-8-5-4-7(12)9(13)10(8)15/h4-6H,1-3H3
InChI key:InChIKey=IIINQDFVLFHIGO-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C=2C(N=C1)=CC=C(F)C2F
Synonyms:- 1-(1,1-Dimethylethyl)-6,7-difluoro-1H-benzimidazole
- 1H-Benzimidazole, 1-(1,1-dimethylethyl)-6,7-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
