CAS 1314987-39-7
:2,3-Dichloro-5-(phenylmethoxy)pyridine
Description:
2,3-Dichloro-5-(phenylmethoxy)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2 and 3 positions with chlorine atoms and at the 5 position with a phenylmethoxy group. This structure contributes to its unique chemical properties, including its potential reactivity and solubility characteristics. The presence of chlorine atoms typically enhances the compound's lipophilicity, which can influence its biological activity and interaction with various biological targets. The phenylmethoxy group may also impart additional stability and influence the compound's electronic properties. This compound may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and can vary based on purity and environmental conditions. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C12H9Cl2NO
InChI:InChI=1S/C12H9Cl2NO/c13-11-6-10(7-15-12(11)14)16-8-9-4-2-1-3-5-9/h1-7H,8H2
InChI key:InChIKey=MBKDILGRPWWOPM-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=C(Cl)C(Cl)=NC2
Synonyms:- 2,3-Dichloro-5-(phenylmethoxy)pyridine
- Pyridine, 2,3-dichloro-5-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
