
CAS 1314987-40-0
:1-Bromo-4-(4-fluorobutoxy)benzene
Description:
1-Bromo-4-(4-fluorobutoxy)benzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and a butoxy group substituted on a benzene ring. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The butoxy group, which contains a fluorine atom, enhances the compound's solubility in organic solvents and may influence its electronic properties. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure suggests that it may exhibit interesting physical properties, such as moderate boiling and melting points, and it may also possess specific biological activities due to the presence of the halogen substituents. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 1-Bromo-4-(4-fluorobutoxy)benzene is a versatile compound with applications in various fields of chemical research.
Formula:C10H12BrFO
InChI:InChI=1S/C10H12BrFO/c11-9-3-5-10(6-4-9)13-8-2-1-7-12/h3-6H,1-2,7-8H2
InChI key:InChIKey=AOLMDZFMAHMJFL-UHFFFAOYSA-N
SMILES:O(CCCCF)C1=CC=C(Br)C=C1
Synonyms:- Benzene, 1-bromo-4-(4-fluorobutoxy)-
- 1-Bromo-4-(4-fluorobutoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.