CAS 1314987-41-1
:4-Fluoro-2-(1-methylbutoxy)-1-nitrobenzene
Description:
4-Fluoro-2-(1-methylbutoxy)-1-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2) and a fluoro group (-F) attached to a benzene ring. The presence of the 1-methylbutoxy substituent introduces an alkoxy functional group, enhancing its solubility in organic solvents. This compound is likely to exhibit moderate polarity due to the combination of the electronegative fluorine and nitro groups, which can influence its reactivity and interaction with other molecules. The nitro group is known for its electron-withdrawing properties, which can affect the compound's electrophilicity and overall chemical behavior. Additionally, the presence of the fluoro group may impart unique properties such as increased stability and altered reactivity compared to its non-fluorinated counterparts. Overall, 4-Fluoro-2-(1-methylbutoxy)-1-nitrobenzene is a compound of interest in various chemical applications, including synthesis and material science, due to its distinctive functional groups and structural characteristics.
Formula:C11H14FNO3
InChI:InChI=1S/C11H14FNO3/c1-3-4-8(2)16-11-7-9(12)5-6-10(11)13(14)15/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=DMGXWZCNPSMBQT-UHFFFAOYSA-N
SMILES:O(C(CCC)C)C1=C(N(=O)=O)C=CC(F)=C1
Synonyms:- Benzene, 4-fluoro-2-(1-methylbutoxy)-1-nitro-
- 4-Fluoro-2-(1-methylbutoxy)-1-nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
