CAS 1314987-59-1
:3-(6-Amino-3-pyridinyl)-N-ethylbenzamide
Description:
3-(6-Amino-3-pyridinyl)-N-ethylbenzamide is a chemical compound characterized by its structural features, which include a pyridine ring substituted with an amino group and an ethylbenzamide moiety. This compound typically exhibits properties associated with both amines and amides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amino and amide functional groups. The pyridine ring contributes to its aromatic character, which can influence its reactivity and interaction with biological systems. The presence of the ethyl group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its specific characteristics, such as melting point, boiling point, and spectral properties, would be determined through experimental methods and could vary based on purity and environmental conditions.
Formula:C14H15N3O
InChI:InChI=1S/C14H15N3O/c1-2-16-14(18)11-5-3-4-10(8-11)12-6-7-13(15)17-9-12/h3-9H,2H2,1H3,(H2,15,17)(H,16,18)
InChI key:InChIKey=XLZKINSFBLIWSN-UHFFFAOYSA-N
SMILES:C(NCC)(=O)C=1C=C(C=CC1)C=2C=CC(N)=NC2
Synonyms:- Benzamide, 3-(6-amino-3-pyridinyl)-N-ethyl-
- 3-(6-Amino-3-pyridinyl)-N-ethylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
