CAS 1314988-10-7
:5-Bromo-6-fluoro-1-(phenylmethyl)-1H-benzimidazole
Description:
5-Bromo-6-fluoro-1-(phenylmethyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with bromine and fluorine atoms, as well as a phenylmethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of halogen substituents, which can influence its reactivity and interaction with biological targets. The presence of the phenylmethyl group may enhance lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the bromine and fluorine atoms can impart distinct electronic properties, making this compound of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many benzimidazole derivatives, it may exhibit a range of pharmacological activities, including antimicrobial, anti-inflammatory, or anticancer properties, warranting further investigation in these areas.
Formula:C14H10BrFN2
InChI:InChI=1S/C14H10BrFN2/c15-11-6-13-14(7-12(11)16)18(9-17-13)8-10-4-2-1-3-5-10/h1-7,9H,8H2
InChI key:InChIKey=WZHHXIVITKECOT-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1)=CC(Br)=C(F)C2)C3=CC=CC=C3
Synonyms:- 5-Bromo-6-fluoro-1-(phenylmethyl)-1H-benzimidazole
- 1H-Benzimidazole, 5-bromo-6-fluoro-1-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
