CAS 13150-57-7
:1-(3,3-diphenylprop-2-en-1-yl)piperidine
Description:
1-(3,3-Diphenylprop-2-en-1-yl)piperidine, identified by its CAS number 13150-57-7, is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a propenyl side chain with two phenyl groups attached to the central carbon, contributing to its unique structural and electronic properties. The presence of the diphenyl moiety enhances its hydrophobic characteristics, potentially influencing its solubility in organic solvents. The compound may exhibit interesting biological activities due to the piperidine structure, which is often found in various pharmacologically active compounds. Additionally, the conjugated double bond in the propenyl group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Its stability and reactivity can be influenced by the steric and electronic effects of the phenyl groups, which may also affect its interaction with biological targets. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and materials science.
Formula:C20H23N
InChI:InChI=1/C20H23N/c1-4-10-18(11-5-1)20(19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21/h1-2,4-7,10-14H,3,8-9,15-17H2
SMILES:c1ccc(cc1)C(=CCN1CCCCC1)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
