CAS 13151-73-0
:DECANE2-CYCLOHEXYL-,2-CYCLOH
Description:
Decane-2-cyclohexyl-,2-cyclohex is a chemical compound characterized by its unique structure, which includes a decane backbone with cyclohexyl groups attached at the second position. This compound falls under the category of aliphatic hydrocarbons and is likely to exhibit properties typical of both alkanes and cycloalkanes. It is expected to be a colorless liquid at room temperature, with a relatively high boiling point due to the presence of multiple carbon atoms and cycloalkyl groups, which can influence its volatility and solubility. The presence of cyclohexyl groups may also impart some degree of rigidity to the molecular structure, affecting its physical properties such as viscosity and density. Additionally, the compound may have limited solubility in water but could be soluble in organic solvents, making it useful in various industrial applications. Safety data sheets would provide specific handling and toxicity information, which is essential for safe usage in laboratory or industrial settings.
Formula:C16H32
InChI:InChI=1S/C16H32/c1-3-4-5-6-7-9-12-15(2)16-13-10-8-11-14-16/h15-16H,3-14H2,1-2H3
Synonyms:- DECANE2-CYCLOHEXYL-,2-CYCLOH
- (1-Methylnonyl)cyclohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
