
CAS 131515-32-7
:Propanedioic acid, 2-bicyclo[1.1.1]pent-1-yl-, 1,3-diethyl ester
Description:
Propanedioic acid, 2-bicyclo[1.1.1]pent-1-yl-, 1,3-diethyl ester, identified by CAS number 131515-32-7, is an organic compound characterized by its structure, which includes a bicyclic system and two ethyl ester groups attached to a propanedioic acid backbone. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having a lower boiling point compared to its corresponding acids. The bicyclic structure contributes to its rigidity and may influence its reactivity and solubility in various solvents. It is likely to participate in typical ester reactions, including hydrolysis and transesterification. The presence of the ethyl groups can enhance its lipophilicity, making it more soluble in organic solvents. Additionally, compounds of this nature may have applications in organic synthesis, materials science, or as intermediates in the production of more complex molecules. However, specific reactivity and stability can vary based on environmental conditions and the presence of other functional groups.
Formula:C12H18O4
InChI:InChI=1S/C12H18O4/c1-3-15-10(13)9(11(14)16-4-2)12-5-8(6-12)7-12/h8-9H,3-7H2,1-2H3
InChI key:InChIKey=QWNCCWQETVLMHP-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C(OCC)=O)C12CC(C1)C2
Synonyms:- Propanedioic acid, bicyclo[1.1.1]pent-1-yl-, diethyl ester
- Bicyclo[1.1.1]pentane, propanedioic acid deriv.
- Propanedioic acid, 2-bicyclo[1.1.1]pent-1-yl-, 1,3-diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.